C35H34INO4 — CID 44572132
13-ethyl-2,3,10-trimethoxy-9-[(4-phenylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide (PubChem CID 44572132) has the molecular formula C35H34INO4 and a molecular weight of 659.56 g/mol. Its IUPAC name is 13-ethyl-2,3,10-trimethoxy-9-[(4-phenylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide.
| Compound Name | 13-ethyl-2,3,10-trimethoxy-9-[(4-phenylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide |
|---|---|
| PubChem CID | 44572132 |
| Molecular Formula | C35H34INO4 |
| Molecular Weight | 659.56 g/mol |
| Exact Mass | 659.15 |
| IUPAC Name | 13-ethyl-2,3,10-trimethoxy-9-[(4-phenylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide |
| SMILES | CCc1c2[n+](cc3c(OCc4ccc(-c5ccccc5)cc4)c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2.[I-] |
| InChI | InChI=1S/C35H34NO4.HI/c1-5-27-28-15-16-31(37-2)35(40-22-23-11-13-25(14-12-23)24-9-7-6-8-10-24)30(28)21-36-18-17-26-19-32(38-3)33(39-4)20-29(26)34(27)36;/h6-16,19-21H,5,17-18,22H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XMAQYGSYOKBWQQ-UHFFFAOYSA-M |
| XLogP | 4.19 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|