C36H37N7O2 — CID 44572236
6-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-4-(pyridin-3-ylmethyl)-1H-quinoxaline-2,3-dione (PubChem CID 44572236) has the molecular formula C36H37N7O2 and a molecular weight of 599.74 g/mol. Its IUPAC name is 6-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-4-(pyridin-3-ylmethyl)-1H-quinoxaline-2,3-dione.
| Compound Name | 6-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-4-(pyridin-3-ylmethyl)-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 44572236 |
| Molecular Formula | C36H37N7O2 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | 6-[[4-[2-(4-tert-butylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]methyl]-4-(pyridin-3-ylmethyl)-1H-quinoxaline-2,3-dione |
| SMILES | CC(C)(C)c1ccc(-c2nc3c(N4CCN(Cc5ccc6[nH]c(=O)c(=O)n(Cc7cccnc7)c6c5)CC4)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C36H37N7O2/c1-36(2,3)27-12-10-26(11-13-27)33-38-29-7-4-8-30(32(29)40-33)42-18-16-41(17-19-42)22-24-9-14-28-31(20-24)43(35(45)34(44)39-28)23-25-6-5-15-37-21-25/h4-15,20-21H,16-19,22-23H2,1-3H3,(H,38,40)(H,39,44) |
| InChIKey | DJBINAQGDWQBRE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|