About [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride
[(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride (PubChem CID 44572305) has the molecular formula C14H16ClNO
and a molecular weight of 249.74 g/mol. Its IUPAC name is [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride |
| PubChem CID | 44572305 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride |
| SMILES | Cl.NC[C@H]1C[C@@H]1c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C14H15NO.ClH/c15-9-12-8-13(12)10-3-5-11(6-4-10)14-2-1-7-16-14;/h1-7,12-13H,8-9,15H2;1H/t12-,13-;/m1./s1 |
| InChIKey | OAVBQCLYBLUERM-OJERSXHUSA-N |
| XLogP | 3.43 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride?
The IUPAC name of [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride (CID 44572305) is [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride.
What is the SMILES notation for [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride?
The canonical SMILES for [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride is Cl.NC[C@H]1C[C@@H]1c1ccc(-c2ccco2)cc1.
What is the InChIKey of [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride?
The InChIKey is OAVBQCLYBLUERM-OJERSXHUSA-N. The full InChI is InChI=1S/C14H15NO.ClH/c15-9-12-8-13(12)10-3-5-11(6-4-10)14-2-1-7-16-14;/h1-7,12-13H,8-9,15H2;1H/t12-,13-;/m1./s1.
What are the key properties of [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride?
[(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride has a molecular weight of 249.74 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-[4-(furan-2-yl)phenyl]cyclopropyl]methanamine;hydrochloride is sourced from PubChem (CID 44572305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).