C26H33N5O5S2 — CID 44572466
benzyl N-[(2S)-1-oxo-1-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]amino]-6-(sulfamoylamino)hexan-2-yl]carbamate (PubChem CID 44572466) has the molecular formula C26H33N5O5S2 and a molecular weight of 559.71 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]amino]-6-(sulfamoylamino)hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]amino]-6-(sulfamoylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 44572466 |
| Molecular Formula | C26H33N5O5S2 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]amino]-6-(sulfamoylamino)hexan-2-yl]carbamate |
| SMILES | CC(C)c1ccc(-c2csc(NC(=O)[C@H](CCCCNS(N)(=O)=O)NC(=O)OCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H33N5O5S2/c1-18(2)20-11-13-21(14-12-20)23-17-37-25(29-23)31-24(32)22(10-6-7-15-28-38(27,34)35)30-26(33)36-16-19-8-4-3-5-9-19/h3-5,8-9,11-14,17-18,22,28H,6-7,10,15-16H2,1-2H3,(H,30,33)(H2,27,34,35)(H,29,31,32)/t22-/m0/s1 |
| InChIKey | IVFPOHHSUTWRCH-QFIPXVFZSA-N |
| XLogP | 4.13 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|