C29H24N6O2S — CID 44572490
4-N-(2-aminophenyl)-1-N-[4-methyl-3-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]benzene-1,4-dicarboxamide (PubChem CID 44572490) has the molecular formula C29H24N6O2S and a molecular weight of 520.62 g/mol. Its IUPAC name is 4-N-(2-aminophenyl)-1-N-[4-methyl-3-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-aminophenyl)-1-N-[4-methyl-3-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 44572490 |
| Molecular Formula | C29H24N6O2S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-N-(2-aminophenyl)-1-N-[4-methyl-3-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]phenyl]benzene-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C(=O)Nc3ccccc3N)cc2)cc1Nc1ncc(-c2cccnc2)s1 |
| InChI | InChI=1S/C29H24N6O2S/c1-18-8-13-22(15-25(18)35-29-32-17-26(38-29)21-5-4-14-31-16-21)33-27(36)19-9-11-20(12-10-19)28(37)34-24-7-3-2-6-23(24)30/h2-17H,30H2,1H3,(H,32,35)(H,33,36)(H,34,37) |
| InChIKey | MMIKNEYLJPHVLH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|