About ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate
ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate (PubChem CID 44572514) has the molecular formula C16H13ClN2O4
and a molecular weight of 332.74 g/mol. Its IUPAC name is ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate |
| PubChem CID | 44572514 |
| Molecular Formula | C16H13ClN2O4 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(COc2ccnc3cc(Cl)ccc23)on1 |
| InChI | InChI=1S/C16H13ClN2O4/c1-2-21-16(20)14-8-11(23-19-14)9-22-15-5-6-18-13-7-10(17)3-4-12(13)15/h3-8H,2,9H2,1H3 |
| InChIKey | QQPWPXXTUDLSGO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate (CID 44572514) is ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate is CCOC(=O)c1cc(COc2ccnc3cc(Cl)ccc23)on1.
What is the InChIKey of ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate?
The InChIKey is QQPWPXXTUDLSGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2O4/c1-2-21-16(20)14-8-11(23-19-14)9-22-15-5-6-18-13-7-10(17)3-4-12(13)15/h3-8H,2,9H2,1H3.
What are the key properties of ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate?
ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate has a molecular weight of 332.74 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(7-chloroquinolin-4-yl)oxymethyl]-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 44572514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).