About 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole
6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole (PubChem CID 44572562) has the molecular formula C12H9N3O3S3
and a molecular weight of 339.42 g/mol. Its IUPAC name is 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole |
| PubChem CID | 44572562 |
| Molecular Formula | C12H9N3O3S3 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole |
| SMILES | CCOc1ccc2nc(Sc3ncc([N+](=O)[O-])s3)sc2c1 |
| InChI | InChI=1S/C12H9N3O3S3/c1-2-18-7-3-4-8-9(5-7)19-12(14-8)21-11-13-6-10(20-11)15(16)17/h3-6H,2H2,1H3 |
| InChIKey | QTTLNQCZQAALHL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole?
The IUPAC name of 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole (CID 44572562) is 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole.
What is the SMILES notation for 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole?
The canonical SMILES for 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole is CCOc1ccc2nc(Sc3ncc([N+](=O)[O-])s3)sc2c1.
What is the InChIKey of 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole?
The InChIKey is QTTLNQCZQAALHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O3S3/c1-2-18-7-3-4-8-9(5-7)19-12(14-8)21-11-13-6-10(20-11)15(16)17/h3-6H,2H2,1H3.
What are the key properties of 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole?
6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole has a molecular weight of 339.42 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3-benzothiazole is sourced from PubChem (CID 44572562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).