About ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate
ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate (PubChem CID 44572602) has the molecular formula C20H14F6N2O3
and a molecular weight of 444.33 g/mol. Its IUPAC name is ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate |
| PubChem CID | 44572602 |
| Molecular Formula | C20H14F6N2O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(COc2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)n1 |
| InChI | InChI=1S/C20H14F6N2O3/c1-2-30-18(29)14-8-3-5-11(27-14)10-31-15-9-16(20(24,25)26)28-17-12(15)6-4-7-13(17)19(21,22)23/h3-9H,2,10H2,1H3 |
| InChIKey | KVHHFQHQIALMSP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate?
The IUPAC name of ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate (CID 44572602) is ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate.
What is the SMILES notation for ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate?
The canonical SMILES for ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate is CCOC(=O)c1cccc(COc2cc(C(F)(F)F)nc3c(C(F)(F)F)cccc23)n1.
What is the InChIKey of ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate?
The InChIKey is KVHHFQHQIALMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F6N2O3/c1-2-30-18(29)14-8-3-5-11(27-14)10-31-15-9-16(20(24,25)26)28-17-12(15)6-4-7-13(17)19(21,22)23/h3-9H,2,10H2,1H3.
What are the key properties of ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate?
ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate has a molecular weight of 444.33 g/mol, XLogP of 5.42, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[[2,8-bis(trifluoromethyl)quinolin-4-yl]oxymethyl]pyridine-2-carboxylate is sourced from PubChem (CID 44572602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).