C21H22O5 — CID 44572634
ethyl 2-[(3S)-5,10-dioxospiro[3,4-dihydrobenzo[g]isochromene-1,1'-cyclopentane]-3-yl]acetate (PubChem CID 44572634) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is ethyl 2-[(3S)-5,10-dioxospiro[3,4-dihydrobenzo[g]isochromene-1,1'-cyclopentane]-3-yl]acetate.
| Compound Name | ethyl 2-[(3S)-5,10-dioxospiro[3,4-dihydrobenzo[g]isochromene-1,1'-cyclopentane]-3-yl]acetate |
|---|---|
| PubChem CID | 44572634 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | ethyl 2-[(3S)-5,10-dioxospiro[3,4-dihydrobenzo[g]isochromene-1,1'-cyclopentane]-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC2=C(C(=O)c3ccccc3C2=O)C2(CCCC2)O1 |
| InChI | InChI=1S/C21H22O5/c1-2-25-17(22)12-13-11-16-18(21(26-13)9-5-6-10-21)20(24)15-8-4-3-7-14(15)19(16)23/h3-4,7-8,13H,2,5-6,9-12H2,1H3/t13-/m0/s1 |
| InChIKey | IBKAUPYHAUVKTA-ZDUSSCGKSA-N |
| XLogP | 3.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|