C26H28N2O4 — CID 44572781
4-(16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaen-20-yl)-N,N-dimethylbutan-1-amine (PubChem CID 44572781) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-(16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaen-20-yl)-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaen-20-yl)-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 44572781 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 4-(16,17-dimethoxy-5,7-dioxa-11-azapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18,20-nonaen-20-yl)-N,N-dimethylbutan-1-amine |
| SMILES | COc1cc2c(CCCCN(C)C)cc3c4cc5c(cc4ncc3c2cc1OC)OCO5 |
| InChI | InChI=1S/C26H28N2O4/c1-28(2)8-6-5-7-16-9-18-20-12-25-26(32-15-31-25)13-22(20)27-14-21(18)19-11-24(30-4)23(29-3)10-17(16)19/h9-14H,5-8,15H2,1-4H3 |
| InChIKey | HIKXOMFXYJPXSI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|