C16H16O5 — CID 44573093
3-(4-methoxyphenyl)-6-(4-methylphenyl)-1,2,4,5-tetraoxane (PubChem CID 44573093) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-6-(4-methylphenyl)-1,2,4,5-tetraoxane.
| Compound Name | 3-(4-methoxyphenyl)-6-(4-methylphenyl)-1,2,4,5-tetraoxane |
|---|---|
| PubChem CID | 44573093 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-(4-methoxyphenyl)-6-(4-methylphenyl)-1,2,4,5-tetraoxane |
| SMILES | COc1ccc(C2OOC(c3ccc(C)cc3)OO2)cc1 |
| InChI | InChI=1S/C16H16O5/c1-11-3-5-12(6-4-11)15-18-20-16(21-19-15)13-7-9-14(17-2)10-8-13/h3-10,15-16H,1-2H3 |
| InChIKey | VMDMARITRITESH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|