C16H18N2O5S — CID 44573129
methyl (2S,3S,8S)-2-ethenylsulfonyl-5-oxo-3-pyridin-3-yl-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate (PubChem CID 44573129) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is methyl (2S,3S,8S)-2-ethenylsulfonyl-5-oxo-3-pyridin-3-yl-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate.
| Compound Name | methyl (2S,3S,8S)-2-ethenylsulfonyl-5-oxo-3-pyridin-3-yl-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 44573129 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | methyl (2S,3S,8S)-2-ethenylsulfonyl-5-oxo-3-pyridin-3-yl-2,3,6,7-tetrahydro-1H-pyrrolizine-8-carboxylate |
| SMILES | C=CS(=O)(=O)[C@H]1C[C@]2(C(=O)OC)CCC(=O)N2[C@H]1c1cccnc1 |
| InChI | InChI=1S/C16H18N2O5S/c1-3-24(21,22)12-9-16(15(20)23-2)7-6-13(19)18(16)14(12)11-5-4-8-17-10-11/h3-5,8,10,12,14H,1,6-7,9H2,2H3/t12-,14-,16-/m0/s1 |
| InChIKey | RVKGRYDBICHMFA-NOLJZWGESA-N |
| XLogP | 0.99 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |