C14H20N2O3S — CID 44573223
4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-ylsulfonyl)morpholine (PubChem CID 44573223) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-ylsulfonyl)morpholine.
| Compound Name | 4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-ylsulfonyl)morpholine |
|---|---|
| PubChem CID | 44573223 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-ylsulfonyl)morpholine |
| SMILES | O=S(=O)(c1ccc2c(c1)CCNCC2)N1CCOCC1 |
| InChI | InChI=1S/C14H20N2O3S/c17-20(18,16-7-9-19-10-8-16)14-2-1-12-3-5-15-6-4-13(12)11-14/h1-2,11,15H,3-10H2 |
| InChIKey | JBRSFEIYDIXRQO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |