C16H18F3IN4O2 — CID 44573248
5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine (PubChem CID 44573248) has the molecular formula C16H18F3IN4O2 and a molecular weight of 482.24 g/mol. Its IUPAC name is 5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44573248 |
| Molecular Formula | C16H18F3IN4O2 |
| Molecular Weight | 482.24 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(C(C)C)c(Oc2cnc(NCC(F)(F)F)nc2N)cc1I |
| InChI | InChI=1S/C16H18F3IN4O2/c1-8(2)9-4-12(25-3)10(20)5-11(9)26-13-6-22-15(24-14(13)21)23-7-16(17,18)19/h4-6,8H,7H2,1-3H3,(H3,21,22,23,24) |
| InChIKey | WEHMBPFRZVWPRY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.24 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|