C16H22IN5O2 — CID 44573287
2-N-(2-aminoethyl)-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine (PubChem CID 44573287) has the molecular formula C16H22IN5O2 and a molecular weight of 443.29 g/mol. Its IUPAC name is 2-N-(2-aminoethyl)-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-aminoethyl)-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 44573287 |
| Molecular Formula | C16H22IN5O2 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 2-N-(2-aminoethyl)-5-(5-iodo-4-methoxy-2-propan-2-ylphenoxy)pyrimidine-2,4-diamine |
| SMILES | COc1cc(C(C)C)c(Oc2cnc(NCCN)nc2N)cc1I |
| InChI | InChI=1S/C16H22IN5O2/c1-9(2)10-6-13(23-3)11(17)7-12(10)24-14-8-21-16(20-5-4-18)22-15(14)19/h6-9H,4-5,18H2,1-3H3,(H3,19,20,21,22) |
| InChIKey | YBCWNNZFGUJLCX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|