About 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole
2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole (PubChem CID 44573448) has the molecular formula C21H15ClF2N2
and a molecular weight of 368.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole |
| PubChem CID | 44573448 |
| Molecular Formula | C21H15ClF2N2 |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole |
| SMILES | Fc1ccc(C2(c3ccc(F)cc3)CN=C(c3ccc(Cl)cc3)N2)cc1 |
| InChI | InChI=1S/C21H15ClF2N2/c22-17-7-1-14(2-8-17)20-25-13-21(26-20,15-3-9-18(23)10-4-15)16-5-11-19(24)12-6-16/h1-12H,13H2,(H,25,26) |
| InChIKey | MRMXQLNSYVKKLS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole?
The IUPAC name of 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole (CID 44573448) is 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole.
What is the SMILES notation for 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole?
The canonical SMILES for 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole is Fc1ccc(C2(c3ccc(F)cc3)CN=C(c3ccc(Cl)cc3)N2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole?
The InChIKey is MRMXQLNSYVKKLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClF2N2/c22-17-7-1-14(2-8-17)20-25-13-21(26-20,15-3-9-18(23)10-4-15)16-5-11-19(24)12-6-16/h1-12H,13H2,(H,25,26).
What are the key properties of 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole?
2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole has a molecular weight of 368.81 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-5,5-bis(4-fluorophenyl)-1,4-dihydroimidazole is sourced from PubChem (CID 44573448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).