About 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide
1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide (PubChem CID 44573616) has the molecular formula C26H27N3O3S
and a molecular weight of 461.59 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide.
Molecular Properties
| Compound Name | 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide |
| PubChem CID | 44573616 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide |
| SMILES | CS(=O)(=O)N1CC2(CCN(C(=O)Nc3ccccc3-c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H27N3O3S/c1-33(31,32)29-19-26(22-12-6-8-14-24(22)29)15-17-28(18-16-26)25(30)27-23-13-7-5-11-21(23)20-9-3-2-4-10-20/h2-14H,15-19H2,1H3,(H,27,30) |
| InChIKey | VZSBKOYYIOBSBY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide?
The IUPAC name of 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide (CID 44573616) is 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide.
What is the SMILES notation for 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide?
The canonical SMILES for 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide is CS(=O)(=O)N1CC2(CCN(C(=O)Nc3ccccc3-c3ccccc3)CC2)c2ccccc21.
What is the InChIKey of 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide?
The InChIKey is VZSBKOYYIOBSBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N3O3S/c1-33(31,32)29-19-26(22-12-6-8-14-24(22)29)15-17-28(18-16-26)25(30)27-23-13-7-5-11-21(23)20-9-3-2-4-10-20/h2-14H,15-19H2,1H3,(H,27,30).
What are the key properties of 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide?
1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide has a molecular weight of 461.59 g/mol, XLogP of 4.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-N-(2-phenylphenyl)spiro[2H-indole-3,4'-piperidine]-1'-carboxamide is sourced from PubChem (CID 44573616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).