C33H37N5O5S — CID 44574068
(7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-methylsulfonyl-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide (PubChem CID 44574068) has the molecular formula C33H37N5O5S and a molecular weight of 615.76 g/mol. Its IUPAC name is (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-methylsulfonyl-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide.
| Compound Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-methylsulfonyl-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide |
|---|---|
| PubChem CID | 44574068 |
| Molecular Formula | C33H37N5O5S |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N-methylsulfonyl-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(=O)NS(C)(=O)=O)c3ncc(-c4ccc5ccccc5c4)[nH]3)c2c1 |
| InChI | InChI=1S/C33H37N5O5S/c1-21-26(27-18-25(43-2)15-16-28(27)35-21)19-32(40)36-29(11-5-4-6-12-31(39)38-44(3,41)42)33-34-20-30(37-33)24-14-13-22-9-7-8-10-23(22)17-24/h7-10,13-18,20,29,35H,4-6,11-12,19H2,1-3H3,(H,34,37)(H,36,40)(H,38,39)/t29-/m0/s1 |
| InChIKey | DVBIJVGEIDAEDU-LJAQVGFWSA-N |
| XLogP | 5.45 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|