C33H34F3N5O5S — CID 44574069
(7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)-N-(trifluoromethylsulfonyl)heptanamide (PubChem CID 44574069) has the molecular formula C33H34F3N5O5S and a molecular weight of 669.73 g/mol. Its IUPAC name is (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)-N-(trifluoromethylsulfonyl)heptanamide.
| Compound Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)-N-(trifluoromethylsulfonyl)heptanamide |
|---|---|
| PubChem CID | 44574069 |
| Molecular Formula | C33H34F3N5O5S |
| Molecular Weight | 669.73 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)-N-(trifluoromethylsulfonyl)heptanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(=O)NS(=O)(=O)C(F)(F)F)c3ncc(-c4ccc5ccccc5c4)[nH]3)c2c1 |
| InChI | InChI=1S/C33H34F3N5O5S/c1-20-25(26-17-24(46-2)14-15-27(26)38-20)18-31(43)39-28(10-4-3-5-11-30(42)41-47(44,45)33(34,35)36)32-37-19-29(40-32)23-13-12-21-8-6-7-9-22(21)16-23/h6-9,12-17,19,28,38H,3-5,10-11,18H2,1-2H3,(H,37,40)(H,39,43)(H,41,42)/t28-/m0/s1 |
| InChIKey | JTOANAIBIIQMCT-NDEPHWFRSA-N |
| XLogP | 6.34 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.73 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|