C38H39N5O3 — CID 44574128
(7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)-N-phenylheptanamide (PubChem CID 44574128) has the molecular formula C38H39N5O3 and a molecular weight of 613.76 g/mol. Its IUPAC name is (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)-N-phenylheptanamide.
| Compound Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)-N-phenylheptanamide |
|---|---|
| PubChem CID | 44574128 |
| Molecular Formula | C38H39N5O3 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.31 |
| IUPAC Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)-N-phenylheptanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(=O)Nc3ccccc3)c3ncc(-c4ccc5ccccc5c4)[nH]3)c2c1 |
| InChI | InChI=1S/C38H39N5O3/c1-25-31(32-22-30(46-2)19-20-33(32)40-25)23-37(45)42-34(15-7-4-8-16-36(44)41-29-13-5-3-6-14-29)38-39-24-35(43-38)28-18-17-26-11-9-10-12-27(26)21-28/h3,5-6,9-14,17-22,24,34,40H,4,7-8,15-16,23H2,1-2H3,(H,39,43)(H,41,44)(H,42,45)/t34-/m0/s1 |
| InChIKey | SNLVALRLYKSWGX-UMSFTDKQSA-N |
| XLogP | 8.02 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|