C34H39N5O3 — CID 44574129
(7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N,N-dimethyl-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide (PubChem CID 44574129) has the molecular formula C34H39N5O3 and a molecular weight of 565.72 g/mol. Its IUPAC name is (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N,N-dimethyl-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide.
| Compound Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N,N-dimethyl-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide |
|---|---|
| PubChem CID | 44574129 |
| Molecular Formula | C34H39N5O3 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | (7S)-7-[[2-(5-methoxy-2-methyl-1H-indol-3-yl)acetyl]amino]-N,N-dimethyl-7-(5-naphthalen-2-yl-1H-imidazol-2-yl)heptanamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(=O)N(C)C)c3ncc(-c4ccc5ccccc5c4)[nH]3)c2c1 |
| InChI | InChI=1S/C34H39N5O3/c1-22-27(28-19-26(42-4)16-17-29(28)36-22)20-32(40)37-30(12-6-5-7-13-33(41)39(2)3)34-35-21-31(38-34)25-15-14-23-10-8-9-11-24(23)18-25/h8-11,14-19,21,30,36H,5-7,12-13,20H2,1-4H3,(H,35,38)(H,37,40)/t30-/m0/s1 |
| InChIKey | MJYVGQWOUBVXNO-PMERELPUSA-N |
| XLogP | 6.47 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|