C18H19N3O3S — CID 44574177
5-[3-(hydroxymethyl)-1,2-oxazol-5-yl]-N-(4-phenyl-1,3-thiazol-2-yl)pentanamide (PubChem CID 44574177) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 5-[3-(hydroxymethyl)-1,2-oxazol-5-yl]-N-(4-phenyl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-[3-(hydroxymethyl)-1,2-oxazol-5-yl]-N-(4-phenyl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 44574177 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 5-[3-(hydroxymethyl)-1,2-oxazol-5-yl]-N-(4-phenyl-1,3-thiazol-2-yl)pentanamide |
| SMILES | O=C(CCCCc1cc(CO)no1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H19N3O3S/c22-11-14-10-15(24-21-14)8-4-5-9-17(23)20-18-19-16(12-25-18)13-6-2-1-3-7-13/h1-3,6-7,10,12,22H,4-5,8-9,11H2,(H,19,20,23) |
| InChIKey | MHNQHJJKXMFDIY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|