About 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide
5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide (PubChem CID 44574206) has the molecular formula C14H21N3O4
and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide |
| PubChem CID | 44574206 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CCCCc1cc(C(=O)NO)no1)NC1CCCC1 |
| InChI | InChI=1S/C14H21N3O4/c18-13(15-10-5-1-2-6-10)8-4-3-7-11-9-12(17-21-11)14(19)16-20/h9-10,20H,1-8H2,(H,15,18)(H,16,19) |
| InChIKey | WUHKYDFXDRUWOB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide (CID 44574206) is 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide is O=C(CCCCc1cc(C(=O)NO)no1)NC1CCCC1.
What is the InChIKey of 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide?
The InChIKey is WUHKYDFXDRUWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O4/c18-13(15-10-5-1-2-6-10)8-4-3-7-11-9-12(17-21-11)14(19)16-20/h9-10,20H,1-8H2,(H,15,18)(H,16,19).
What are the key properties of 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide?
5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide has a molecular weight of 295.34 g/mol, XLogP of 1.57, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(cyclopentylamino)-5-oxopentyl]-N-hydroxy-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 44574206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).