C27H30N2O5S — CID 44574214
N-[(7R,8R)-8-[(4-ethylphenyl)sulfonylamino]-7-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-2-(3-methoxyphenyl)acetamide (PubChem CID 44574214) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is N-[(7R,8R)-8-[(4-ethylphenyl)sulfonylamino]-7-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[(7R,8R)-8-[(4-ethylphenyl)sulfonylamino]-7-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 44574214 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[(7R,8R)-8-[(4-ethylphenyl)sulfonylamino]-7-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-2-(3-methoxyphenyl)acetamide |
| SMILES | CCc1ccc(S(=O)(=O)N[C@@H]2c3cc(NC(=O)Cc4cccc(OC)c4)ccc3CC[C@H]2O)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c1-3-18-7-12-23(13-8-18)35(32,33)29-27-24-17-21(11-9-20(24)10-14-25(27)30)28-26(31)16-19-5-4-6-22(15-19)34-2/h4-9,11-13,15,17,25,27,29-30H,3,10,14,16H2,1-2H3,(H,28,31)/t25-,27-/m1/s1 |
| InChIKey | WJNHYJHZIDWVRZ-XNMGPUDCSA-N |
| XLogP | 3.77 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |