C21H28N2O5 — CID 44574779
(3R,9S)-3-benzyl-9-methoxycarbonyl-3-(prop-2-enoxycarbonylamino)-5-azoniaspiro[4.4]nonan-4-olate (PubChem CID 44574779) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is (3R,9S)-3-benzyl-9-methoxycarbonyl-3-(prop-2-enoxycarbonylamino)-5-azoniaspiro[4.4]nonan-4-olate.
| Compound Name | (3R,9S)-3-benzyl-9-methoxycarbonyl-3-(prop-2-enoxycarbonylamino)-5-azoniaspiro[4.4]nonan-4-olate |
|---|---|
| PubChem CID | 44574779 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (3R,9S)-3-benzyl-9-methoxycarbonyl-3-(prop-2-enoxycarbonylamino)-5-azoniaspiro[4.4]nonan-4-olate |
| SMILES | C=CCOC(=O)N[C@]1(Cc2ccccc2)CC[N+]2(CCC[C@H]2C(=O)OC)C1[O-] |
| InChI | InChI=1S/C21H28N2O5/c1-3-14-28-20(26)22-21(15-16-8-5-4-6-9-16)11-13-23(19(21)25)12-7-10-17(23)18(24)27-2/h3-6,8-9,17,19H,1,7,10-15H2,2H3,(H,22,26)/t17-,19?,21-,23?/m0/s1 |
| InChIKey | BCDWGPXFWBFXES-MUAQXQJPSA-N |
| XLogP | 1.12 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|