About 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 44574985) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 44574985 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | COc1ccc(C2Cc3nccn3C2)cc1 |
| InChI | InChI=1S/C13H14N2O/c1-16-12-4-2-10(3-5-12)11-8-13-14-6-7-15(13)9-11/h2-7,11H,8-9H2,1H3 |
| InChIKey | CQPRHMLRHXLMEL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 44574985) is 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is COc1ccc(C2Cc3nccn3C2)cc1.
What is the InChIKey of 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is CQPRHMLRHXLMEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O/c1-16-12-4-2-10(3-5-12)11-8-13-14-6-7-15(13)9-11/h2-7,11H,8-9H2,1H3.
What are the key properties of 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 214.27 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 44574985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).