About 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 44574989) has the molecular formula C14H16N2O
and a molecular weight of 228.30 g/mol. Its IUPAC name is 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 44574989 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | COCc1ccccc1C1Cc2nccn2C1 |
| InChI | InChI=1S/C14H16N2O/c1-17-10-11-4-2-3-5-13(11)12-8-14-15-6-7-16(14)9-12/h2-7,12H,8-10H2,1H3 |
| InChIKey | VLRKQMQYVWMCDX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 44574989) is 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is COCc1ccccc1C1Cc2nccn2C1.
What is the InChIKey of 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is VLRKQMQYVWMCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O/c1-17-10-11-4-2-3-5-13(11)12-8-14-15-6-7-16(14)9-12/h2-7,12H,8-10H2,1H3.
What are the key properties of 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 228.30 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(methoxymethyl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 44574989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).