C20H24O8 — CID 44575028
(4S,15E)-21-hydroxy-19-methoxy-4-methyl-3,9,12-trioxabicyclo[15.4.0]henicosa-1(17),15,18,20-tetraene-2,8,13-trione (PubChem CID 44575028) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is (4S,15E)-21-hydroxy-19-methoxy-4-methyl-3,9,12-trioxabicyclo[15.4.0]henicosa-1(17),15,18,20-tetraene-2,8,13-trione.
| Compound Name | (4S,15E)-21-hydroxy-19-methoxy-4-methyl-3,9,12-trioxabicyclo[15.4.0]henicosa-1(17),15,18,20-tetraene-2,8,13-trione |
|---|---|
| PubChem CID | 44575028 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (4S,15E)-21-hydroxy-19-methoxy-4-methyl-3,9,12-trioxabicyclo[15.4.0]henicosa-1(17),15,18,20-tetraene-2,8,13-trione |
| SMILES | COc1cc(O)c2c(c1)/C=C/CC(=O)OCCOC(=O)CCC[C@H](C)OC2=O |
| InChI | InChI=1S/C20H24O8/c1-13-5-3-7-17(22)26-9-10-27-18(23)8-4-6-14-11-15(25-2)12-16(21)19(14)20(24)28-13/h4,6,11-13,21H,3,5,7-10H2,1-2H3/b6-4+/t13-/m0/s1 |
| InChIKey | OSKKLULYFAZOGL-BPJJOFIESA-N |
| XLogP | 2.62 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|