C26H32O5 — CID 44575185
1,8-dihydroxy-3-[(E)-7-methoxy-3,7-dimethyloct-2-enoxy]-6-methyl-10H-anthracen-9-one (PubChem CID 44575185) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1,8-dihydroxy-3-[(E)-7-methoxy-3,7-dimethyloct-2-enoxy]-6-methyl-10H-anthracen-9-one.
| Compound Name | 1,8-dihydroxy-3-[(E)-7-methoxy-3,7-dimethyloct-2-enoxy]-6-methyl-10H-anthracen-9-one |
|---|---|
| PubChem CID | 44575185 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1,8-dihydroxy-3-[(E)-7-methoxy-3,7-dimethyloct-2-enoxy]-6-methyl-10H-anthracen-9-one |
| SMILES | COC(C)(C)CCC/C(C)=C/COc1cc(O)c2c(c1)Cc1cc(C)cc(O)c1C2=O |
| InChI | InChI=1S/C26H32O5/c1-16(7-6-9-26(3,4)30-5)8-10-31-20-14-19-13-18-11-17(2)12-21(27)23(18)25(29)24(19)22(28)15-20/h8,11-12,14-15,27-28H,6-7,9-10,13H2,1-5H3/b16-8+ |
| InChIKey | VQCWKJINHIKPIZ-LZYBPNLTSA-N |
| XLogP | 5.46 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|