C19H24O5 — CID 44575288
(6aR,7R,8S,10aS)-8-methyl-7-[2-[(3S)-5-oxooxolan-3-yl]ethyl]-5,6,6a,7,8,10-hexahydro-1H-benzo[d][2]benzofuran-3,9-dione (PubChem CID 44575288) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (6aR,7R,8S,10aS)-8-methyl-7-[2-[(3S)-5-oxooxolan-3-yl]ethyl]-5,6,6a,7,8,10-hexahydro-1H-benzo[d][2]benzofuran-3,9-dione.
| Compound Name | (6aR,7R,8S,10aS)-8-methyl-7-[2-[(3S)-5-oxooxolan-3-yl]ethyl]-5,6,6a,7,8,10-hexahydro-1H-benzo[d][2]benzofuran-3,9-dione |
|---|---|
| PubChem CID | 44575288 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (6aR,7R,8S,10aS)-8-methyl-7-[2-[(3S)-5-oxooxolan-3-yl]ethyl]-5,6,6a,7,8,10-hexahydro-1H-benzo[d][2]benzofuran-3,9-dione |
| SMILES | C[C@@H]1C(=O)C[C@@]23COC(=O)C2=CCC[C@@H]3[C@H]1CC[C@@H]1COC(=O)C1 |
| InChI | InChI=1S/C19H24O5/c1-11-13(6-5-12-7-17(21)23-9-12)14-3-2-4-15-18(22)24-10-19(14,15)8-16(11)20/h4,11-14H,2-3,5-10H2,1H3/t11-,12-,13-,14+,19-/m0/s1 |
| InChIKey | ICFFHPZZHODBJN-NNSCZBDESA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |