C21H30O2 — CID 44575324
(1S,2S,4aS,10aR)-1-(hydroxymethyl)-1,4a-dimethyl-9-methylidene-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-2-ol (PubChem CID 44575324) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (1S,2S,4aS,10aR)-1-(hydroxymethyl)-1,4a-dimethyl-9-methylidene-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-2-ol.
| Compound Name | (1S,2S,4aS,10aR)-1-(hydroxymethyl)-1,4a-dimethyl-9-methylidene-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-2-ol |
|---|---|
| PubChem CID | 44575324 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (1S,2S,4aS,10aR)-1-(hydroxymethyl)-1,4a-dimethyl-9-methylidene-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-2-ol |
| SMILES | C=C1C[C@H]2[C@@](C)(CO)[C@@H](O)CC[C@]2(C)c2ccc(C(C)C)cc21 |
| InChI | InChI=1S/C21H30O2/c1-13(2)15-6-7-17-16(11-15)14(3)10-18-20(17,4)9-8-19(23)21(18,5)12-22/h6-7,11,13,18-19,22-23H,3,8-10,12H2,1-2,4-5H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | RNJJNEPXIZLMLZ-PLACYPQZSA-N |
| XLogP | 4.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |