C21H26O7 — CID 44575343
(1S,2R,4S,5S,6R,8Z,11Z,14S,15S)-5,6-dihydroxy-8,12-dimethyl-4-prop-1-en-2-yl-16,18,19-trioxatetracyclo[12.2.2.12,6.01,15]nonadeca-8,11-diene-10,17-dione (PubChem CID 44575343) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is (1S,2R,4S,5S,6R,8Z,11Z,14S,15S)-5,6-dihydroxy-8,12-dimethyl-4-prop-1-en-2-yl-16,18,19-trioxatetracyclo[12.2.2.12,6.01,15]nonadeca-8,11-diene-10,17-dione.
| Compound Name | (1S,2R,4S,5S,6R,8Z,11Z,14S,15S)-5,6-dihydroxy-8,12-dimethyl-4-prop-1-en-2-yl-16,18,19-trioxatetracyclo[12.2.2.12,6.01,15]nonadeca-8,11-diene-10,17-dione |
|---|---|
| PubChem CID | 44575343 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (1S,2R,4S,5S,6R,8Z,11Z,14S,15S)-5,6-dihydroxy-8,12-dimethyl-4-prop-1-en-2-yl-16,18,19-trioxatetracyclo[12.2.2.12,6.01,15]nonadeca-8,11-diene-10,17-dione |
| SMILES | C=C(C)[C@@H]1C[C@H]2O[C@](O)(C/C(C)=C\C(=O)/C=C(/C)C[C@@H]3OC(=O)[C@]24O[C@@H]34)[C@H]1O |
| InChI | InChI=1S/C21H26O7/c1-10(2)14-8-16-21-18(28-21)15(26-19(21)24)7-11(3)5-13(22)6-12(4)9-20(25,27-16)17(14)23/h5-6,14-18,23,25H,1,7-9H2,2-4H3/b11-5-,12-6-/t14-,15-,16+,17-,18-,20+,21-/m0/s1 |
| InChIKey | LSGGQQXXRXYKET-ABGRTZACSA-N |
| XLogP | 1.34 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|