C22H32O5 — CID 44575421
[(2S,6S,8aR)-2-ethoxy-6,8a-dimethyl-4,7-dioxo-3-propan-2-yl-1,2,5,8-tetrahydroazulen-6-yl] (Z)-2-methylbut-2-enoate (PubChem CID 44575421) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(2S,6S,8aR)-2-ethoxy-6,8a-dimethyl-4,7-dioxo-3-propan-2-yl-1,2,5,8-tetrahydroazulen-6-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2S,6S,8aR)-2-ethoxy-6,8a-dimethyl-4,7-dioxo-3-propan-2-yl-1,2,5,8-tetrahydroazulen-6-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 44575421 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(2S,6S,8aR)-2-ethoxy-6,8a-dimethyl-4,7-dioxo-3-propan-2-yl-1,2,5,8-tetrahydroazulen-6-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@]1(C)CC(=O)C2=C(C(C)C)[C@@H](OCC)C[C@]2(C)CC1=O |
| InChI | InChI=1S/C22H32O5/c1-8-14(5)20(25)27-22(7)10-15(23)19-18(13(3)4)16(26-9-2)11-21(19,6)12-17(22)24/h8,13,16H,9-12H2,1-7H3/b14-8-/t16-,21+,22-/m0/s1 |
| InChIKey | FHWTXEUDQYBBHR-NUAIMQSUSA-N |
| XLogP | 3.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|