About ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate
ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate (PubChem CID 44575470) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate |
| PubChem CID | 44575470 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate |
| SMILES | CCCC[C@H](C)CC1(CC)C=C(CC)C(CC(=O)OCC)OO1 |
| InChI | InChI=1S/C19H34O4/c1-6-10-11-15(5)13-19(8-3)14-16(7-2)17(22-23-19)12-18(20)21-9-4/h14-15,17H,6-13H2,1-5H3/t15-,17?,19?/m0/s1 |
| InChIKey | YADXRWVJOHJGHS-DMKPSLHHSA-N |
| XLogP | 4.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate?
The IUPAC name of ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate (CID 44575470) is ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate.
What is the SMILES notation for ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate?
The canonical SMILES for ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate is CCCC[C@H](C)CC1(CC)C=C(CC)C(CC(=O)OCC)OO1.
What is the InChIKey of ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate?
The InChIKey is YADXRWVJOHJGHS-DMKPSLHHSA-N. The full InChI is InChI=1S/C19H34O4/c1-6-10-11-15(5)13-19(8-3)14-16(7-2)17(22-23-19)12-18(20)21-9-4/h14-15,17H,6-13H2,1-5H3/t15-,17?,19?/m0/s1.
What are the key properties of ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate?
ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate has a molecular weight of 326.48 g/mol, XLogP of 4.97, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4,6-diethyl-6-[(2S)-2-methylhexyl]-3H-1,2-dioxin-3-yl]acetate is sourced from PubChem (CID 44575470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).