C9H17NaO10S — CID 44575487
sodium [(2S,3S,4S,5R,6S)-6-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonate (PubChem CID 44575487) has the molecular formula C9H17NaO10S and a molecular weight of 340.28 g/mol. Its IUPAC name is sodium [(2S,3S,4S,5R,6S)-6-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonate.
| Compound Name | sodium [(2S,3S,4S,5R,6S)-6-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 44575487 |
| Molecular Formula | C9H17NaO10S |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | sodium [(2S,3S,4S,5R,6S)-6-[(2R)-2,3-dihydroxypropoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonate |
| SMILES | O=S(=O)([O-])C[C@H]1O[C@H](OC[C@H](O)CO)[C@H](O)[C@@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C9H18O10S.Na/c10-1-4(11)2-18-9-8(14)7(13)6(12)5(19-9)3-20(15,16)17;/h4-14H,1-3H2,(H,15,16,17);/q;+1/p-1/t4-,5-,6-,7+,8-,9+;/m1./s1 |
| InChIKey | WVJQMTBDUPJZIS-CWWFDSDNSA-M |
| XLogP | -7.29 |
| TPSA | 176.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | -7.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|