C28H36O12 — CID 44575512
[(1S,2S,4S,7S,8Z,11S,12S,13R,14S,16S,17R,18S)-1,11,12-triacetyloxy-16-hydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate (PubChem CID 44575512) has the molecular formula C28H36O12 and a molecular weight of 564.58 g/mol. Its IUPAC name is [(1S,2S,4S,7S,8Z,11S,12S,13R,14S,16S,17R,18S)-1,11,12-triacetyloxy-16-hydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate.
| Compound Name | [(1S,2S,4S,7S,8Z,11S,12S,13R,14S,16S,17R,18S)-1,11,12-triacetyloxy-16-hydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate |
|---|---|
| PubChem CID | 44575512 |
| Molecular Formula | C28H36O12 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(1S,2S,4S,7S,8Z,11S,12S,13R,14S,16S,17R,18S)-1,11,12-triacetyloxy-16-hydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](O)[C@H](C)[C@H]2[C@@]1(C)[C@]1(OC(C)=O)[C@@H](OC(C)=O)C/C(C)=C\[C@@H]3OC(=O)[C@@]4(C)O[C@]34[C@]21OC(C)=O |
| InChI | InChI=1S/C28H36O12/c1-12-9-20(36-15(4)30)26(38-16(5)31)24(7)19(35-14(3)29)11-18(33)13(2)22(24)28(26,39-17(6)32)27-21(10-12)37-23(34)25(27,8)40-27/h10,13,18-22,33H,9,11H2,1-8H3/b12-10-/t13-,18-,19-,20-,21-,22-,24-,25+,26+,27+,28-/m0/s1 |
| InChIKey | AUEFUUCAYXEJJT-FBNOZLGZSA-N |
| XLogP | 1.29 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|