C26H34O11 — CID 44575513
[(1S,2S,4S,7S,8Z,11S,12S,13R,14S,16S,17R,18S)-1,11-diacetyloxy-12,16-dihydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate (PubChem CID 44575513) has the molecular formula C26H34O11 and a molecular weight of 522.55 g/mol. Its IUPAC name is [(1S,2S,4S,7S,8Z,11S,12S,13R,14S,16S,17R,18S)-1,11-diacetyloxy-12,16-dihydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate.
| Compound Name | [(1S,2S,4S,7S,8Z,11S,12S,13R,14S,16S,17R,18S)-1,11-diacetyloxy-12,16-dihydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate |
|---|---|
| PubChem CID | 44575513 |
| Molecular Formula | C26H34O11 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [(1S,2S,4S,7S,8Z,11S,12S,13R,14S,16S,17R,18S)-1,11-diacetyloxy-12,16-dihydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](O)[C@H](C)[C@H]2[C@@]1(C)[C@]1(O)[C@@H](OC(C)=O)C/C(C)=C\[C@@H]3OC(=O)[C@@]4(C)O[C@]34[C@]21OC(C)=O |
| InChI | InChI=1S/C26H34O11/c1-11-8-18(34-14(4)28)24(32)22(6)17(33-13(3)27)10-16(30)12(2)20(22)26(24,36-15(5)29)25-19(9-11)35-21(31)23(25,7)37-25/h9,12,16-20,30,32H,8,10H2,1-7H3/b11-9-/t12-,16-,17-,18-,19-,20-,22-,23+,24+,25+,26-/m0/s1 |
| InChIKey | QOSVVDSZORDOQG-UONOOGLHSA-N |
| XLogP | 0.72 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|