C24H32O9 — CID 44575515
[(1S,2S,4S,7S,8Z,12R,13R,14S,16S,17R,18S)-12-acetyloxy-1,16-dihydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate (PubChem CID 44575515) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is [(1S,2S,4S,7S,8Z,12R,13R,14S,16S,17R,18S)-12-acetyloxy-1,16-dihydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate.
| Compound Name | [(1S,2S,4S,7S,8Z,12R,13R,14S,16S,17R,18S)-12-acetyloxy-1,16-dihydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate |
|---|---|
| PubChem CID | 44575515 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(1S,2S,4S,7S,8Z,12R,13R,14S,16S,17R,18S)-12-acetyloxy-1,16-dihydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](O)[C@H](C)[C@H]2[C@@]1(C)[C@]1(OC(C)=O)CC/C(C)=C\[C@@H]3OC(=O)[C@@]4(C)O[C@]34[C@]21O |
| InChI | InChI=1S/C24H32O9/c1-11-7-8-22(32-14(4)26)20(5)16(30-13(3)25)10-15(27)12(2)18(20)23(22,29)24-17(9-11)31-19(28)21(24,6)33-24/h9,12,15-18,27,29H,7-8,10H2,1-6H3/b11-9-/t12-,15-,16-,17-,18-,20-,21+,22+,23-,24+/m0/s1 |
| InChIKey | GUVBXRZCFNTRBW-KLEDXUJXSA-N |
| XLogP | 1.18 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|