C26H34O10 — CID 44575517
[(1S,2S,4S,7S,8Z,12R,13R,14S,16S,17R,18S)-12,14-diacetyloxy-1-hydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-16-yl] acetate (PubChem CID 44575517) has the molecular formula C26H34O10 and a molecular weight of 506.55 g/mol. Its IUPAC name is [(1S,2S,4S,7S,8Z,12R,13R,14S,16S,17R,18S)-12,14-diacetyloxy-1-hydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-16-yl] acetate.
| Compound Name | [(1S,2S,4S,7S,8Z,12R,13R,14S,16S,17R,18S)-12,14-diacetyloxy-1-hydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-16-yl] acetate |
|---|---|
| PubChem CID | 44575517 |
| Molecular Formula | C26H34O10 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | [(1S,2S,4S,7S,8Z,12R,13R,14S,16S,17R,18S)-12,14-diacetyloxy-1-hydroxy-4,9,13,17-tetramethyl-5-oxo-3,6-dioxapentacyclo[10.6.0.02,4.02,7.013,18]octadec-8-en-16-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](OC(C)=O)[C@@]2(C)[C@H]([C@H]1C)[C@]1(O)[C@@]2(OC(C)=O)CC/C(C)=C\[C@@H]2OC(=O)[C@@]3(C)O[C@@]213 |
| InChI | InChI=1S/C26H34O10/c1-12-8-9-24(35-16(5)29)22(6)18(33-15(4)28)11-17(32-14(3)27)13(2)20(22)25(24,31)26-19(10-12)34-21(30)23(26,7)36-26/h10,13,17-20,31H,8-9,11H2,1-7H3/b12-10-/t13-,17-,18-,19-,20-,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | XCFTUEKBYWIJDG-ORWZVTHWSA-N |
| XLogP | 1.75 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|