C20H26O5 — CID 44575567
(1S,2R,5S,8S,9R,11R,15S,18R)-15,18-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-7,16-dione (PubChem CID 44575567) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1S,2R,5S,8S,9R,11R,15S,18R)-15,18-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-7,16-dione.
| Compound Name | (1S,2R,5S,8S,9R,11R,15S,18R)-15,18-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-7,16-dione |
|---|---|
| PubChem CID | 44575567 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1S,2R,5S,8S,9R,11R,15S,18R)-15,18-dihydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-7,16-dione |
| SMILES | C=C1C(=O)[C@@]23[C@@H](CC[C@@H]1[C@H]2O)[C@@]12C(=O)O[C@@H]3C[C@@H]1C(C)(C)CC[C@@H]2O |
| InChI | InChI=1S/C20H26O5/c1-9-10-4-5-11-19-12(18(2,3)7-6-13(19)21)8-14(25-17(19)24)20(11,15(9)22)16(10)23/h10-14,16,21,23H,1,4-8H2,2-3H3/t10-,11-,12+,13-,14+,16+,19+,20-/m0/s1 |
| InChIKey | WERAVKCWKIBKGM-DZDBYSCMSA-N |
| XLogP | 1.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|