C40H68O2 — CID 44575794
[(E)-3,7,11,15-tetramethylhexadec-2-enyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 44575794) has the molecular formula C40H68O2 and a molecular weight of 580.98 g/mol. Its IUPAC name is [(E)-3,7,11,15-tetramethylhexadec-2-enyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [(E)-3,7,11,15-tetramethylhexadec-2-enyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 44575794 |
| Molecular Formula | C40H68O2 |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.52 |
| IUPAC Name | [(E)-3,7,11,15-tetramethylhexadec-2-enyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C40H68O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-33-40(41)42-35-34-39(6)32-26-31-38(5)30-25-29-37(4)28-24-27-36(2)3/h8-9,11-12,14-15,17-18,20-21,34,36-38H,7,10,13,16,19,22-33,35H2,1-6H3/b9-8-,12-11-,15-14-,18-17-,21-20-,39-34+ |
| InChIKey | YUWCQHLMAWBPEI-YOWCENDASA-N |
| XLogP | 12.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|