C15H26O — CID 44575859
(1R,5R,6S,9R,10S)-5,6,10-trimethyltricyclo[7.2.1.01,6]dodecan-10-ol (PubChem CID 44575859) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (1R,5R,6S,9R,10S)-5,6,10-trimethyltricyclo[7.2.1.01,6]dodecan-10-ol.
| Compound Name | (1R,5R,6S,9R,10S)-5,6,10-trimethyltricyclo[7.2.1.01,6]dodecan-10-ol |
|---|---|
| PubChem CID | 44575859 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (1R,5R,6S,9R,10S)-5,6,10-trimethyltricyclo[7.2.1.01,6]dodecan-10-ol |
| SMILES | C[C@@H]1CCC[C@]23C[C@@H](CC[C@@]12C)[C@@](C)(O)C3 |
| InChI | InChI=1S/C15H26O/c1-11-5-4-7-15-9-12(14(3,16)10-15)6-8-13(11,15)2/h11-12,16H,4-10H2,1-3H3/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | XMGYHZMNIUZSLJ-NIFZNCRKSA-N |
| XLogP | 3.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |