C22H34O3 — CID 44575873
[(3R,3aS,5E,9E,11S,12aR)-10-(hydroxymethyl)-6,12a-dimethyl-3-prop-1-en-2-yl-2,3,3a,4,7,8,11,12-octahydro-1H-cyclopenta[11]annulen-11-yl] acetate (PubChem CID 44575873) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(3R,3aS,5E,9E,11S,12aR)-10-(hydroxymethyl)-6,12a-dimethyl-3-prop-1-en-2-yl-2,3,3a,4,7,8,11,12-octahydro-1H-cyclopenta[11]annulen-11-yl] acetate.
| Compound Name | [(3R,3aS,5E,9E,11S,12aR)-10-(hydroxymethyl)-6,12a-dimethyl-3-prop-1-en-2-yl-2,3,3a,4,7,8,11,12-octahydro-1H-cyclopenta[11]annulen-11-yl] acetate |
|---|---|
| PubChem CID | 44575873 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(3R,3aS,5E,9E,11S,12aR)-10-(hydroxymethyl)-6,12a-dimethyl-3-prop-1-en-2-yl-2,3,3a,4,7,8,11,12-octahydro-1H-cyclopenta[11]annulen-11-yl] acetate |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)C[C@H](OC(C)=O)/C(CO)=C/CC/C(C)=C/C[C@@H]12 |
| InChI | InChI=1S/C22H34O3/c1-15(2)19-11-12-22(5)13-21(25-17(4)24)18(14-23)8-6-7-16(3)9-10-20(19)22/h8-9,19-21,23H,1,6-7,10-14H2,2-5H3/b16-9+,18-8+/t19-,20-,21-,22+/m0/s1 |
| InChIKey | NYEBMQJPLBYHSD-QJEOOICSSA-N |
| XLogP | 4.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|