C25H40O5 — CID 44575887
methyl (2R)-2-[(3S,6R)-6-[(2S,3aS,4R,5aS,9aR,9bR)-3a,4,7,9b-tetramethyl-2,3,4,5,5a,8,9,9a-octahydrobenzo[g][1]benzofuran-2-yl]-6-methyldioxan-3-yl]propanoate (PubChem CID 44575887) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is methyl (2R)-2-[(3S,6R)-6-[(2S,3aS,4R,5aS,9aR,9bR)-3a,4,7,9b-tetramethyl-2,3,4,5,5a,8,9,9a-octahydrobenzo[g][1]benzofuran-2-yl]-6-methyldioxan-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(3S,6R)-6-[(2S,3aS,4R,5aS,9aR,9bR)-3a,4,7,9b-tetramethyl-2,3,4,5,5a,8,9,9a-octahydrobenzo[g][1]benzofuran-2-yl]-6-methyldioxan-3-yl]propanoate |
|---|---|
| PubChem CID | 44575887 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | methyl (2R)-2-[(3S,6R)-6-[(2S,3aS,4R,5aS,9aR,9bR)-3a,4,7,9b-tetramethyl-2,3,4,5,5a,8,9,9a-octahydrobenzo[g][1]benzofuran-2-yl]-6-methyldioxan-3-yl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@@H]1CC[C@](C)([C@@H]2C[C@@]3(C)[C@H](C)C[C@H]4C=C(C)CC[C@H]4[C@@]3(C)O2)OO1 |
| InChI | InChI=1S/C25H40O5/c1-15-8-9-19-18(12-15)13-16(2)23(4)14-21(28-25(19,23)6)24(5)11-10-20(29-30-24)17(3)22(26)27-7/h12,16-21H,8-11,13-14H2,1-7H3/t16-,17-,18-,19-,20+,21+,23+,24-,25-/m1/s1 |
| InChIKey | ZUKFYDKHJLXOAT-MCOBSHKRSA-N |
| XLogP | 5.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|