C43H72O10 — CID 44575947
[(2R,13R)-13-acetyloxy-13-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-acetyloxyundecyl]oxolan-2-yl]oxolan-2-yl]-1-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]tridecan-2-yl] acetate (PubChem CID 44575947) has the molecular formula C43H72O10 and a molecular weight of 749.04 g/mol. Its IUPAC name is [(2R,13R)-13-acetyloxy-13-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-acetyloxyundecyl]oxolan-2-yl]oxolan-2-yl]-1-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]tridecan-2-yl] acetate.
| Compound Name | [(2R,13R)-13-acetyloxy-13-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-acetyloxyundecyl]oxolan-2-yl]oxolan-2-yl]-1-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]tridecan-2-yl] acetate |
|---|---|
| PubChem CID | 44575947 |
| Molecular Formula | C43H72O10 |
| Molecular Weight | 749.04 g/mol |
| Exact Mass | 748.51 |
| IUPAC Name | [(2R,13R)-13-acetyloxy-13-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-acetyloxyundecyl]oxolan-2-yl]oxolan-2-yl]-1-[(2S)-2-methyl-5-oxo-2H-furan-4-yl]tridecan-2-yl] acetate |
| SMILES | CCCCCCCCCC[C@H](OC(C)=O)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](CCCCCCCCCC[C@H](CC3=C[C@H](C)OC3=O)OC(C)=O)OC(C)=O)O2)O1 |
| InChI | InChI=1S/C43H72O10/c1-6-7-8-9-10-14-17-20-23-37(50-33(4)45)39-25-27-41(52-39)42-28-26-40(53-42)38(51-34(5)46)24-21-18-15-12-11-13-16-19-22-36(49-32(3)44)30-35-29-31(2)48-43(35)47/h29,31,36-42H,6-28,30H2,1-5H3/t31-,36+,37-,38+,39+,40+,41+,42+/m0/s1 |
| InChIKey | XSROKWVIBRHQHL-DFUWCKDTSA-N |
| XLogP | 9.57 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.04 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|