C41H70O9 — CID 44575948
[(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-acetyloxy-11-[(2R,4S)-5-oxo-4-(2-oxopropyl)oxolan-2-yl]undecyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate (PubChem CID 44575948) has the molecular formula C41H70O9 and a molecular weight of 707.00 g/mol. Its IUPAC name is [(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-acetyloxy-11-[(2R,4S)-5-oxo-4-(2-oxopropyl)oxolan-2-yl]undecyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate.
| Compound Name | [(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-acetyloxy-11-[(2R,4S)-5-oxo-4-(2-oxopropyl)oxolan-2-yl]undecyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate |
|---|---|
| PubChem CID | 44575948 |
| Molecular Formula | C41H70O9 |
| Molecular Weight | 707.00 g/mol |
| Exact Mass | 706.50 |
| IUPAC Name | [(1S)-1-[(2R,5R)-5-[(2R,5R)-5-[(1R)-1-acetyloxy-11-[(2R,4S)-5-oxo-4-(2-oxopropyl)oxolan-2-yl]undecyl]oxolan-2-yl]oxolan-2-yl]undecyl] acetate |
| SMILES | CCCCCCCCCC[C@H](OC(C)=O)[C@H]1CC[C@H]([C@H]2CC[C@H]([C@@H](CCCCCCCCCC[C@@H]3C[C@@H](CC(C)=O)C(=O)O3)OC(C)=O)O2)O1 |
| InChI | InChI=1S/C41H70O9/c1-5-6-7-8-9-13-16-19-22-35(46-31(3)43)37-24-26-39(49-37)40-27-25-38(50-40)36(47-32(4)44)23-20-17-14-11-10-12-15-18-21-34-29-33(28-30(2)42)41(45)48-34/h33-40H,5-29H2,1-4H3/t33-,34-,35+,36-,37-,38-,39-,40-/m1/s1 |
| InChIKey | VAFJUECWFWHTBT-GVFSPJTFSA-N |
| XLogP | 9.29 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.00 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|