C22H34O10 — CID 44576036
[(1S,4aS,7aS)-7-(hydroxymethyl)-7a-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4a,5-dihydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate (PubChem CID 44576036) has the molecular formula C22H34O10 and a molecular weight of 458.50 g/mol. Its IUPAC name is [(1S,4aS,7aS)-7-(hydroxymethyl)-7a-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4a,5-dihydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate.
| Compound Name | [(1S,4aS,7aS)-7-(hydroxymethyl)-7a-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4a,5-dihydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 44576036 |
| Molecular Formula | C22H34O10 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [(1S,4aS,7aS)-7-(hydroxymethyl)-7a-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4a,5-dihydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)O[C@@H]1OC=C(CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2CC=C(CO)[C@@]12C |
| InChI | InChI=1S/C22H34O10/c1-11(2)6-16(25)32-21-22(3)13(7-23)4-5-14(22)12(10-30-21)9-29-20-19(28)18(27)17(26)15(8-24)31-20/h4,10-11,14-15,17-21,23-24,26-28H,5-9H2,1-3H3/t14-,15+,17+,18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | KDLVLOOLZKBQEV-WVJNYEJGSA-N |
| XLogP | -0.42 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|