C30H42O5 — CID 44576097
(1R,2R,5R,10R,11R,14S,15R,16S,17S,20R,22S)-1,2,6,6,10,22-hexamethylspiro[19-oxahexacyclo[12.10.0.02,11.05,10.015,22.016,20]tetracosane-17,2'-oxirane]-4,7,18-trione (PubChem CID 44576097) has the molecular formula C30H42O5 and a molecular weight of 482.66 g/mol. Its IUPAC name is (1R,2R,5R,10R,11R,14S,15R,16S,17S,20R,22S)-1,2,6,6,10,22-hexamethylspiro[19-oxahexacyclo[12.10.0.02,11.05,10.015,22.016,20]tetracosane-17,2'-oxirane]-4,7,18-trione.
| Compound Name | (1R,2R,5R,10R,11R,14S,15R,16S,17S,20R,22S)-1,2,6,6,10,22-hexamethylspiro[19-oxahexacyclo[12.10.0.02,11.05,10.015,22.016,20]tetracosane-17,2'-oxirane]-4,7,18-trione |
|---|---|
| PubChem CID | 44576097 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | (1R,2R,5R,10R,11R,14S,15R,16S,17S,20R,22S)-1,2,6,6,10,22-hexamethylspiro[19-oxahexacyclo[12.10.0.02,11.05,10.015,22.016,20]tetracosane-17,2'-oxirane]-4,7,18-trione |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@H]3CC[C@H]4[C@@H]5[C@H]6[C@@H](C[C@]5(C)CC[C@@]4(C)[C@]3(C)CC(=O)[C@@H]12)OC(=O)[C@@]61CO1 |
| InChI | InChI=1S/C30H42O5/c1-25(2)20(32)9-10-27(4)19-8-7-16-21-22-18(35-24(33)30(22)15-34-30)14-26(21,3)11-12-28(16,5)29(19,6)13-17(31)23(25)27/h16,18-19,21-23H,7-15H2,1-6H3/t16-,18+,19+,21+,22+,23-,26-,27+,28+,29+,30+/m0/s1 |
| InChIKey | IUHZXPYTKHFUND-JWAQLJLISA-N |
| XLogP | 5.14 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|