C21H32O2 — CID 44576135
methyl 3-[(1S,4S,5R,6R,8R,9R,10R)-5,9-dimethyl-4-prop-1-en-2-yl-5-tetracyclo[7.2.1.01,6.08,10]dodecanyl]propanoate (PubChem CID 44576135) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is methyl 3-[(1S,4S,5R,6R,8R,9R,10R)-5,9-dimethyl-4-prop-1-en-2-yl-5-tetracyclo[7.2.1.01,6.08,10]dodecanyl]propanoate.
| Compound Name | methyl 3-[(1S,4S,5R,6R,8R,9R,10R)-5,9-dimethyl-4-prop-1-en-2-yl-5-tetracyclo[7.2.1.01,6.08,10]dodecanyl]propanoate |
|---|---|
| PubChem CID | 44576135 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | methyl 3-[(1S,4S,5R,6R,8R,9R,10R)-5,9-dimethyl-4-prop-1-en-2-yl-5-tetracyclo[7.2.1.01,6.08,10]dodecanyl]propanoate |
| SMILES | C=C(C)[C@@H]1CC[C@@]23C[C@@H]4[C@@H](C[C@H]2[C@]1(C)CCC(=O)OC)[C@@]4(C)C3 |
| InChI | InChI=1S/C21H32O2/c1-13(2)14-6-9-21-11-16-15(20(16,4)12-21)10-17(21)19(14,3)8-7-18(22)23-5/h14-17H,1,6-12H2,2-5H3/t14-,15+,16+,17-,19+,20+,21-/m0/s1 |
| InChIKey | MPBHKLGEOJDYPD-JORSEVEOSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|