C20H30O3 — CID 44576148
methyl 3-[(1S,5S,8R,9R,10R)-4-acetyl-5,9-dimethyl-5-tetracyclo[7.2.1.01,6.08,10]dodecanyl]propanoate (PubChem CID 44576148) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is methyl 3-[(1S,5S,8R,9R,10R)-4-acetyl-5,9-dimethyl-5-tetracyclo[7.2.1.01,6.08,10]dodecanyl]propanoate.
| Compound Name | methyl 3-[(1S,5S,8R,9R,10R)-4-acetyl-5,9-dimethyl-5-tetracyclo[7.2.1.01,6.08,10]dodecanyl]propanoate |
|---|---|
| PubChem CID | 44576148 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | methyl 3-[(1S,5S,8R,9R,10R)-4-acetyl-5,9-dimethyl-5-tetracyclo[7.2.1.01,6.08,10]dodecanyl]propanoate |
| SMILES | COC(=O)CC[C@]1(C)C(C(C)=O)CC[C@@]23C[C@@H]4[C@@H](CC21)[C@@]4(C)C3 |
| InChI | InChI=1S/C20H30O3/c1-12(21)13-5-8-20-10-15-14(19(15,3)11-20)9-16(20)18(13,2)7-6-17(22)23-4/h13-16H,5-11H2,1-4H3/t13?,14-,15-,16?,18-,19-,20+/m1/s1 |
| InChIKey | YHMZNLLPIFLTSK-QOLHWYMLSA-N |
| XLogP | 4.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |